C17H21NOS — CID 79830804
3-methoxy-4-[(2,4,6-trimethylphenyl)methylsulfanyl]aniline (PubChem CID 79830804) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-methoxy-4-[(2,4,6-trimethylphenyl)methylsulfanyl]aniline.
| Compound Name | 3-methoxy-4-[(2,4,6-trimethylphenyl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79830804 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-methoxy-4-[(2,4,6-trimethylphenyl)methylsulfanyl]aniline |
| SMILES | COc1cc(N)ccc1SCc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H21NOS/c1-11-7-12(2)15(13(3)8-11)10-20-17-6-5-14(18)9-16(17)19-4/h5-9H,10,18H2,1-4H3 |
| InChIKey | JGJPYZDKDCXNCH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|