About 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole
2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 79831749) has the molecular formula C12H10BrNS
and a molecular weight of 280.19 g/mol. Its IUPAC name is 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| PubChem CID | 79831749 |
| Molecular Formula | C12H10BrNS |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 278.97 |
| IUPAC Name | 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| SMILES | Brc1ccccc1-c1nc2c(s1)CCC2 |
| InChI | InChI=1S/C12H10BrNS/c13-9-5-2-1-4-8(9)12-14-10-6-3-7-11(10)15-12/h1-2,4-5H,3,6-7H2 |
| InChIKey | QFUNIYOHRDSWQR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The IUPAC name of 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (CID 79831749) is 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
What is the SMILES notation for 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The canonical SMILES for 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is Brc1ccccc1-c1nc2c(s1)CCC2.
What is the InChIKey of 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The InChIKey is QFUNIYOHRDSWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNS/c13-9-5-2-1-4-8(9)12-14-10-6-3-7-11(10)15-12/h1-2,4-5H,3,6-7H2.
What are the key properties of 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole has a molecular weight of 280.19 g/mol, XLogP of 4.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromophenyl)-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is sourced from PubChem (CID 79831749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).