About Veratrylamine
Veratrylamine (PubChem CID 79832) has the molecular formula C9H13NO2
and a molecular weight of 167.20 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methanamine.
Molecular Properties
| Compound Name | Veratrylamine |
| PubChem CID | 79832 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | (3,4-dimethoxyphenyl)methanamine |
| SMILES | COC1=C(C=C(C=C1)CN)OC |
| InChI | InChI=1S/C9H13NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6,10H2,1-2H3 |
| InChIKey | DIVNUTGTTIRPQA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 130 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Veratrylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Veratrylamine?
The IUPAC name of Veratrylamine (CID 79832) is (3,4-dimethoxyphenyl)methanamine.
What is the SMILES notation for Veratrylamine?
The canonical SMILES for Veratrylamine is COC1=C(C=C(C=C1)CN)OC.
What is the InChIKey of Veratrylamine?
The InChIKey is DIVNUTGTTIRPQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6,10H2,1-2H3.
What are the key properties of Veratrylamine?
Veratrylamine has a molecular weight of 167.20 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Veratrylamine is sourced from PubChem (CID 79832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).