C14H18BrNO2 — CID 79833485
methyl (2R)-1-[(2-bromophenyl)methyl]piperidine-2-carboxylate (PubChem CID 79833485) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is methyl (2R)-1-[(2-bromophenyl)methyl]piperidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[(2-bromophenyl)methyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 79833485 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | methyl (2R)-1-[(2-bromophenyl)methyl]piperidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCCCN1Cc1ccccc1Br |
| InChI | InChI=1S/C14H18BrNO2/c1-18-14(17)13-8-4-5-9-16(13)10-11-6-2-3-7-12(11)15/h2-3,6-7,13H,4-5,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | LMVZCPDOBKVZHH-CYBMUJFWSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |