About 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline
3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline (PubChem CID 79835004) has the molecular formula C15H19BrF3N
and a molecular weight of 350.22 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline |
| PubChem CID | 79835004 |
| Molecular Formula | C15H19BrF3N |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline |
| SMILES | CC1(C)CCCCC1Nc1cc(Br)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19BrF3N/c1-14(2)6-4-3-5-13(14)20-12-8-10(15(17,18)19)7-11(16)9-12/h7-9,13,20H,3-6H2,1-2H3 |
| InChIKey | IQDPFDKNACQONP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline?
The IUPAC name of 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline (CID 79835004) is 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline.
What is the SMILES notation for 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline?
The canonical SMILES for 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline is CC1(C)CCCCC1Nc1cc(Br)cc(C(F)(F)F)c1.
What is the InChIKey of 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline?
The InChIKey is IQDPFDKNACQONP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrF3N/c1-14(2)6-4-3-5-13(14)20-12-8-10(15(17,18)19)7-11(16)9-12/h7-9,13,20H,3-6H2,1-2H3.
What are the key properties of 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline?
3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline has a molecular weight of 350.22 g/mol, XLogP of 5.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2,2-dimethylcyclohexyl)-5-(trifluoromethyl)aniline is sourced from PubChem (CID 79835004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).