About N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline
N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline (PubChem CID 79835492) has the molecular formula C17H22N2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline.
Molecular Properties
| Compound Name | N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline |
| PubChem CID | 79835492 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline |
| SMILES | CC1(C)CCCCC1Nc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C17H22N2S/c1-17(2)9-4-3-8-15(17)19-14-7-5-6-13(12-14)16-18-10-11-20-16/h5-7,10-12,15,19H,3-4,8-9H2,1-2H3 |
| InChIKey | GIKHJGJTNXMOHD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline?
The IUPAC name of N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline (CID 79835492) is N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline.
What is the SMILES notation for N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline?
The canonical SMILES for N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline is CC1(C)CCCCC1Nc1cccc(-c2nccs2)c1.
What is the InChIKey of N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline?
The InChIKey is GIKHJGJTNXMOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2S/c1-17(2)9-4-3-8-15(17)19-14-7-5-6-13(12-14)16-18-10-11-20-16/h5-7,10-12,15,19H,3-4,8-9H2,1-2H3.
What are the key properties of N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline?
N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline has a molecular weight of 286.44 g/mol, XLogP of 5.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethylcyclohexyl)-3-(1,3-thiazol-2-yl)aniline is sourced from PubChem (CID 79835492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).