C16H25NO2 — CID 79836385
6-(4-ethoxyphenoxy)-2,2-dimethylcyclohexan-1-amine (PubChem CID 79836385) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-(4-ethoxyphenoxy)-2,2-dimethylcyclohexan-1-amine.
| Compound Name | 6-(4-ethoxyphenoxy)-2,2-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79836385 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 6-(4-ethoxyphenoxy)-2,2-dimethylcyclohexan-1-amine |
| SMILES | CCOc1ccc(OC2CCCC(C)(C)C2N)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-4-18-12-7-9-13(10-8-12)19-14-6-5-11-16(2,3)15(14)17/h7-10,14-15H,4-6,11,17H2,1-3H3 |
| InChIKey | NJIIPFNGASOMGC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |