C13H13N5O2S — CID 79836702
5-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (PubChem CID 79836702) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 5-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 5-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 79836702 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 5-[(4-amino-2-methoxyphenyl)sulfanylmethyl]-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1cc(N)ccc1SCc1cc(=O)n2[nH]cnc2n1 |
| InChI | InChI=1S/C13H13N5O2S/c1-20-10-4-8(14)2-3-11(10)21-6-9-5-12(19)18-13(17-9)15-7-16-18/h2-5,7H,6,14H2,1H3,(H,15,16,17) |
| InChIKey | GDOFDBULPZMLED-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|