C11H11Br2Cl — CID 79837589
4,7-dibromo-1-chloro-3,3-dimethyl-1,2-dihydroindene (PubChem CID 79837589) has the molecular formula C11H11Br2Cl and a molecular weight of 338.47 g/mol. Its IUPAC name is 4,7-dibromo-1-chloro-3,3-dimethyl-1,2-dihydroindene.
| Compound Name | 4,7-dibromo-1-chloro-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 79837589 |
| Molecular Formula | C11H11Br2Cl |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | 4,7-dibromo-1-chloro-3,3-dimethyl-1,2-dihydroindene |
| SMILES | CC1(C)CC(Cl)c2c(Br)ccc(Br)c21 |
| InChI | InChI=1S/C11H11Br2Cl/c1-11(2)5-8(14)9-6(12)3-4-7(13)10(9)11/h3-4,8H,5H2,1-2H3 |
| InChIKey | LGFHHIDCDNEWKG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|