C15H20O3 — CID 79837678
(9S)-3,7,7-trimethyl-3,4,8,9-tetrahydro-2H-cyclopenta[h][1,5]benzodioxepin-9-ol (PubChem CID 79837678) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (9S)-3,7,7-trimethyl-3,4,8,9-tetrahydro-2H-cyclopenta[h][1,5]benzodioxepin-9-ol.
| Compound Name | (9S)-3,7,7-trimethyl-3,4,8,9-tetrahydro-2H-cyclopenta[h][1,5]benzodioxepin-9-ol |
|---|---|
| PubChem CID | 79837678 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (9S)-3,7,7-trimethyl-3,4,8,9-tetrahydro-2H-cyclopenta[h][1,5]benzodioxepin-9-ol |
| SMILES | CC1COc2cc3c(cc2OC1)C(C)(C)C[C@@H]3O |
| InChI | InChI=1S/C15H20O3/c1-9-7-17-13-4-10-11(5-14(13)18-8-9)15(2,3)6-12(10)16/h4-5,9,12,16H,6-8H2,1-3H3/t9?,12-/m0/s1 |
| InChIKey | HOTPZJNIXJAZGV-ACGXKRRESA-N |
| XLogP | 2.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |