C12H14Br2O — CID 79837869
1,7-dibromo-4-methoxy-3,3-dimethyl-1,2-dihydroindene (PubChem CID 79837869) has the molecular formula C12H14Br2O and a molecular weight of 334.05 g/mol. Its IUPAC name is 1,7-dibromo-4-methoxy-3,3-dimethyl-1,2-dihydroindene.
| Compound Name | 1,7-dibromo-4-methoxy-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 79837869 |
| Molecular Formula | C12H14Br2O |
| Molecular Weight | 334.05 g/mol |
| Exact Mass | 331.94 |
| IUPAC Name | 1,7-dibromo-4-methoxy-3,3-dimethyl-1,2-dihydroindene |
| SMILES | COc1ccc(Br)c2c1C(C)(C)CC2Br |
| InChI | InChI=1S/C12H14Br2O/c1-12(2)6-8(14)10-7(13)4-5-9(15-3)11(10)12/h4-5,8H,6H2,1-3H3 |
| InChIKey | NHLKMPVRUBYVDC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.05 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|