About (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol
(1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol (PubChem CID 79837956) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol.
Molecular Properties
| Compound Name | (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol |
| PubChem CID | 79837956 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol |
| SMILES | CC1(C)C[C@H](O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C11H13BrO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6H2,1-2H3/t10-/m0/s1 |
| InChIKey | OXIZEXSPMCKKTO-JTQLQIEISA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol?
The IUPAC name of (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol (CID 79837956) is (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol.
What is the SMILES notation for (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol?
The canonical SMILES for (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol is CC1(C)C[C@H](O)c2cc(Br)ccc21.
What is the InChIKey of (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol?
The InChIKey is OXIZEXSPMCKKTO-JTQLQIEISA-N. The full InChI is InChI=1S/C11H13BrO/c1-11(2)6-10(13)8-5-7(12)3-4-9(8)11/h3-5,10,13H,6H2,1-2H3/t10-/m0/s1.
What are the key properties of (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol?
(1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol has a molecular weight of 241.13 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-6-bromo-3,3-dimethyl-1,2-dihydroinden-1-ol is sourced from PubChem (CID 79837956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).