C13H15FO — CID 79838020
6-fluoro-3,3,5,7-tetramethyl-2H-inden-1-one (PubChem CID 79838020) has the molecular formula C13H15FO and a molecular weight of 206.26 g/mol. Its IUPAC name is 6-fluoro-3,3,5,7-tetramethyl-2H-inden-1-one.
| Compound Name | 6-fluoro-3,3,5,7-tetramethyl-2H-inden-1-one |
|---|---|
| PubChem CID | 79838020 |
| Molecular Formula | C13H15FO |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 6-fluoro-3,3,5,7-tetramethyl-2H-inden-1-one |
| SMILES | Cc1cc2c(c(C)c1F)C(=O)CC2(C)C |
| InChI | InChI=1S/C13H15FO/c1-7-5-9-11(8(2)12(7)14)10(15)6-13(9,3)4/h5H,6H2,1-4H3 |
| InChIKey | ZEDNTDICUBRMLM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |