C13H19NO — CID 79838026
4-methoxy-3,3,7-trimethyl-1,2-dihydroinden-1-amine (PubChem CID 79838026) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-methoxy-3,3,7-trimethyl-1,2-dihydroinden-1-amine.
| Compound Name | 4-methoxy-3,3,7-trimethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79838026 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-methoxy-3,3,7-trimethyl-1,2-dihydroinden-1-amine |
| SMILES | COc1ccc(C)c2c1C(C)(C)CC2N |
| InChI | InChI=1S/C13H19NO/c1-8-5-6-10(15-4)12-11(8)9(14)7-13(12,2)3/h5-6,9H,7,14H2,1-4H3 |
| InChIKey | UXGBXWCYICHNRI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |