About 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene
4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene (PubChem CID 79838104) has the molecular formula C11H13BrCl2
and a molecular weight of 296.04 g/mol. Its IUPAC name is 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene.
Molecular Properties
| Compound Name | 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene |
| PubChem CID | 79838104 |
| Molecular Formula | C11H13BrCl2 |
| Molecular Weight | 296.04 g/mol |
| Exact Mass | 293.96 |
| IUPAC Name | 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene |
| SMILES | CC(C)(CCBr)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H13BrCl2/c1-11(2,5-6-12)8-3-4-9(13)10(14)7-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | UCUDLUFQBOPUDK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.04 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene?
The IUPAC name of 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene (CID 79838104) is 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene.
What is the SMILES notation for 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene?
The canonical SMILES for 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene is CC(C)(CCBr)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene?
The InChIKey is UCUDLUFQBOPUDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrCl2/c1-11(2,5-6-12)8-3-4-9(13)10(14)7-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene?
4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene has a molecular weight of 296.04 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-2-methylbutan-2-yl)-1,2-dichlorobenzene is sourced from PubChem (CID 79838104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).