About 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene
3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene (PubChem CID 79838159) has the molecular formula C15H14BrCl
and a molecular weight of 309.63 g/mol. Its IUPAC name is 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene.
Molecular Properties
| Compound Name | 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene |
| PubChem CID | 79838159 |
| Molecular Formula | C15H14BrCl |
| Molecular Weight | 309.63 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene |
| SMILES | CC1(C)CC(Br)c2cc(Cl)c3ccccc3c21 |
| InChI | InChI=1S/C15H14BrCl/c1-15(2)8-12(16)11-7-13(17)9-5-3-4-6-10(9)14(11)15/h3-7,12H,8H2,1-2H3 |
| InChIKey | VOOLMOJZLZBKJV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene?
The IUPAC name of 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene (CID 79838159) is 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene.
What is the SMILES notation for 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene?
The canonical SMILES for 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene is CC1(C)CC(Br)c2cc(Cl)c3ccccc3c21.
What is the InChIKey of 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene?
The InChIKey is VOOLMOJZLZBKJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrCl/c1-15(2)8-12(16)11-7-13(17)9-5-3-4-6-10(9)14(11)15/h3-7,12H,8H2,1-2H3.
What are the key properties of 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene?
3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene has a molecular weight of 309.63 g/mol, XLogP of 5.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-chloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene is sourced from PubChem (CID 79838159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).