C15H14Cl2 — CID 79838258
3,5-dichloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene (PubChem CID 79838258) has the molecular formula C15H14Cl2 and a molecular weight of 265.18 g/mol. Its IUPAC name is 3,5-dichloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene.
| Compound Name | 3,5-dichloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 79838258 |
| Molecular Formula | C15H14Cl2 |
| Molecular Weight | 265.18 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 3,5-dichloro-1,1-dimethyl-2,3-dihydrocyclopenta[a]naphthalene |
| SMILES | CC1(C)CC(Cl)c2cc(Cl)c3ccccc3c21 |
| InChI | InChI=1S/C15H14Cl2/c1-15(2)8-13(17)11-7-12(16)9-5-3-4-6-10(9)14(11)15/h3-7,13H,8H2,1-2H3 |
| InChIKey | WPWNDFXMOGSNRV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.18 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|