C13H18ClN — CID 79838335
(1S)-6-chloro-3,3,4,7-tetramethyl-1,2-dihydroinden-1-amine (PubChem CID 79838335) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is (1S)-6-chloro-3,3,4,7-tetramethyl-1,2-dihydroinden-1-amine.
| Compound Name | (1S)-6-chloro-3,3,4,7-tetramethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79838335 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (1S)-6-chloro-3,3,4,7-tetramethyl-1,2-dihydroinden-1-amine |
| SMILES | Cc1cc(Cl)c(C)c2c1C(C)(C)C[C@@H]2N |
| InChI | InChI=1S/C13H18ClN/c1-7-5-9(14)8(2)11-10(15)6-13(3,4)12(7)11/h5,10H,6,15H2,1-4H3/t10-/m0/s1 |
| InChIKey | ZNMCAYLRDMTNMU-JTQLQIEISA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |