C13H18O — CID 79838530
(1R)-3,3,4,6-tetramethyl-1,2-dihydroinden-1-ol (PubChem CID 79838530) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (1R)-3,3,4,6-tetramethyl-1,2-dihydroinden-1-ol.
| Compound Name | (1R)-3,3,4,6-tetramethyl-1,2-dihydroinden-1-ol |
|---|---|
| PubChem CID | 79838530 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (1R)-3,3,4,6-tetramethyl-1,2-dihydroinden-1-ol |
| SMILES | Cc1cc(C)c2c(c1)[C@H](O)CC2(C)C |
| InChI | InChI=1S/C13H18O/c1-8-5-9(2)12-10(6-8)11(14)7-13(12,3)4/h5-6,11,14H,7H2,1-4H3/t11-/m1/s1 |
| InChIKey | NHWKJIUIIMIBJL-LLVKDONJSA-N |
| XLogP | 3.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |