About 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one
3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one (PubChem CID 79838813) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one |
| PubChem CID | 79838813 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one |
| SMILES | Cc1csc(=O)n1CC(O)CO |
| InChI | InChI=1S/C7H11NO3S/c1-5-4-12-7(11)8(5)2-6(10)3-9/h4,6,9-10H,2-3H2,1H3 |
| InChIKey | GCVWCZLTMHAYCD-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The IUPAC name of 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one (CID 79838813) is 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one.
What is the SMILES notation for 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The canonical SMILES for 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one is Cc1csc(=O)n1CC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one?
The InChIKey is GCVWCZLTMHAYCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S/c1-5-4-12-7(11)8(5)2-6(10)3-9/h4,6,9-10H,2-3H2,1H3.
What are the key properties of 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one?
3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one has a molecular weight of 189.24 g/mol, XLogP of -0.43, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropyl)-4-methyl-1,3-thiazol-2-one is sourced from PubChem (CID 79838813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).