C12H16N4O — CID 79839054
(2S)-3-methyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)butan-1-ol (PubChem CID 79839054) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is (2S)-3-methyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)butan-1-ol.
| Compound Name | (2S)-3-methyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)butan-1-ol |
|---|---|
| PubChem CID | 79839054 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2S)-3-methyl-2-(pyrido[2,3-b]pyrazin-6-ylamino)butan-1-ol |
| SMILES | CC(C)[C@@H](CO)Nc1ccc2nccnc2n1 |
| InChI | InChI=1S/C12H16N4O/c1-8(2)10(7-17)15-11-4-3-9-12(16-11)14-6-5-13-9/h3-6,8,10,17H,7H2,1-2H3,(H,14,15,16)/t10-/m1/s1 |
| InChIKey | NXGCRJLRQCMNNX-SNVBAGLBSA-N |
| XLogP | 1.45 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |