C7H13N3O2 — CID 79839285
3-(3,5-dimethyl-1,2,4-triazol-1-yl)propane-1,2-diol (PubChem CID 79839285) has the molecular formula C7H13N3O2 and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2,4-triazol-1-yl)propane-1,2-diol.
| Compound Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 79839285 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-(3,5-dimethyl-1,2,4-triazol-1-yl)propane-1,2-diol |
| SMILES | Cc1nc(C)n(CC(O)CO)n1 |
| InChI | InChI=1S/C7H13N3O2/c1-5-8-6(2)10(9-5)3-7(12)4-11/h7,11-12H,3-4H2,1-2H3 |
| InChIKey | GFWIMIPPCGAXJI-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |