About methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate
methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate (PubChem CID 79839516) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate |
| PubChem CID | 79839516 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate |
| SMILES | COC(=O)CC1CN(c2nc(C(C)C)ns2)CCO1 |
| InChI | InChI=1S/C12H19N3O3S/c1-8(2)11-13-12(19-14-11)15-4-5-18-9(7-15)6-10(16)17-3/h8-9H,4-7H2,1-3H3 |
| InChIKey | JWSFNJSRDDAROM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate?
The IUPAC name of methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate (CID 79839516) is methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate.
What is the SMILES notation for methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate?
The canonical SMILES for methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate is COC(=O)CC1CN(c2nc(C(C)C)ns2)CCO1.
What is the InChIKey of methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate?
The InChIKey is JWSFNJSRDDAROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-8(2)11-13-12(19-14-11)15-4-5-18-9(7-15)6-10(16)17-3/h8-9H,4-7H2,1-3H3.
What are the key properties of methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate?
methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate has a molecular weight of 285.37 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(3-propan-2-yl-1,2,4-thiadiazol-5-yl)morpholin-2-yl]acetate is sourced from PubChem (CID 79839516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).