About 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine
2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine (PubChem CID 798404) has the molecular formula C13H12ClFN2S
and a molecular weight of 282.76 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine |
| PubChem CID | 798404 |
| Molecular Formula | C13H12ClFN2S |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4,6-dimethylpyrimidine |
| SMILES | CC1=CC(=NC(=N1)SCC2=C(C=CC=C2Cl)F)C |
| InChI | InChI=1S/C13H12ClFN2S/c1-8-6-9(2)17-13(16-8)18-7-10-11(14)4-3-5-12(10)15/h3-6H,7H2,1-2H3 |
| InChIKey | PCSVLZBIHQQTQM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 51.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | 259 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine?
The IUPAC name of 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine (CID 798404) is 2-[(2-chloro-6-fluorophenyl)methylsulfanyl]-4,6-dimethylpyrimidine.
What is the SMILES notation for 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine?
The canonical SMILES for 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine is CC1=CC(=NC(=N1)SCC2=C(C=CC=C2Cl)F)C.
What is the InChIKey of 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine?
The InChIKey is PCSVLZBIHQQTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12ClFN2S/c1-8-6-9(2)17-13(16-8)18-7-10-11(14)4-3-5-12(10)15/h3-6H,7H2,1-2H3.
What are the key properties of 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine?
2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine has a molecular weight of 282.76 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-Chloro-6-fluoro-benzylsulfanyl)-4,6-dimethyl-pyrimidine is sourced from PubChem (CID 798404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).