C13H20ClN3 — CID 79840472
N'-(3-chloro-4-pyridinyl)-N'-cyclohexylethane-1,2-diamine (PubChem CID 79840472) has the molecular formula C13H20ClN3 and a molecular weight of 253.78 g/mol. Its IUPAC name is N'-(3-chloro-4-pyridinyl)-N'-cyclohexylethane-1,2-diamine.
| Compound Name | N'-(3-chloro-4-pyridinyl)-N'-cyclohexylethane-1,2-diamine |
|---|---|
| PubChem CID | 79840472 |
| Molecular Formula | C13H20ClN3 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N'-(3-chloro-4-pyridinyl)-N'-cyclohexylethane-1,2-diamine |
| SMILES | NCCN(c1ccncc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C13H20ClN3/c14-12-10-16-8-6-13(12)17(9-7-15)11-4-2-1-3-5-11/h6,8,10-11H,1-5,7,9,15H2 |
| InChIKey | JZWSWTXCVLXFAL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |