About N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine
N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine (PubChem CID 79841429) has the molecular formula C11H18ClN3O
and a molecular weight of 243.74 g/mol. Its IUPAC name is N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 79841429 |
| Molecular Formula | C11H18ClN3O |
| Molecular Weight | 243.74 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine |
| SMILES | COCCNCCN(C)c1ccncc1Cl |
| InChI | InChI=1S/C11H18ClN3O/c1-15(7-5-13-6-8-16-2)11-3-4-14-9-10(11)12/h3-4,9,13H,5-8H2,1-2H3 |
| InChIKey | DSANKSGPQQCPJG-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine (CID 79841429) is N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine is COCCNCCN(C)c1ccncc1Cl.
What is the InChIKey of N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
The InChIKey is DSANKSGPQQCPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClN3O/c1-15(7-5-13-6-8-16-2)11-3-4-14-9-10(11)12/h3-4,9,13H,5-8H2,1-2H3.
What are the key properties of N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine?
N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine has a molecular weight of 243.74 g/mol, XLogP of 1.41, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-chloro-4-pyridinyl)-N-(2-methoxyethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 79841429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).