About 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine
4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine (PubChem CID 79842762) has the molecular formula C16H34N2O2S
and a molecular weight of 318.53 g/mol. Its IUPAC name is 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine.
Molecular Properties
| Compound Name | 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine |
| PubChem CID | 79842762 |
| Molecular Formula | C16H34N2O2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine |
| SMILES | CCNC1CCC(C(C)(C)C)CC1N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C16H34N2O2S/c1-7-17-14-9-8-13(16(2,3)4)12-15(14)18(5)10-11-21(6,19)20/h13-15,17H,7-12H2,1-6H3 |
| InChIKey | LBFLDXVNJBYFDY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine?
The IUPAC name of 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine (CID 79842762) is 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine.
What is the SMILES notation for 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine?
The canonical SMILES for 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine is CCNC1CCC(C(C)(C)C)CC1N(C)CCS(C)(=O)=O.
What is the InChIKey of 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine?
The InChIKey is LBFLDXVNJBYFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O2S/c1-7-17-14-9-8-13(16(2,3)4)12-15(14)18(5)10-11-21(6,19)20/h13-15,17H,7-12H2,1-6H3.
What are the key properties of 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine?
4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine has a molecular weight of 318.53 g/mol, XLogP of 2.16, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1-N-ethyl-2-N-methyl-2-N-(2-methylsulfonylethyl)cyclohexane-1,2-diamine is sourced from PubChem (CID 79842762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).