C19H40N2 — CID 79842872
N-ethyl-2,2-dimethyl-6-[[pentyl(propan-2-yl)amino]methyl]cyclohexan-1-amine (PubChem CID 79842872) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-6-[[pentyl(propan-2-yl)amino]methyl]cyclohexan-1-amine.
| Compound Name | N-ethyl-2,2-dimethyl-6-[[pentyl(propan-2-yl)amino]methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 79842872 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | N-ethyl-2,2-dimethyl-6-[[pentyl(propan-2-yl)amino]methyl]cyclohexan-1-amine |
| SMILES | CCCCCN(CC1CCCC(C)(C)C1NCC)C(C)C |
| InChI | InChI=1S/C19H40N2/c1-7-9-10-14-21(16(3)4)15-17-12-11-13-19(5,6)18(17)20-8-2/h16-18,20H,7-15H2,1-6H3 |
| InChIKey | BEFNDRBWTFJFGC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|