About ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate
ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate (PubChem CID 798455) has the molecular formula C19H21N3O3
and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate |
| PubChem CID | 798455 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)N(C(=O)CN)c1ccccc1CC2 |
| InChI | InChI=1S/C19H21N3O3/c1-2-25-19(24)21-15-10-9-14-8-7-13-5-3-4-6-16(13)22(17(14)11-15)18(23)12-20/h3-6,9-11H,2,7-8,12,20H2,1H3,(H,21,24) |
| InChIKey | HJGLLZCKMKRCLO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate?
The IUPAC name of ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate (CID 798455) is ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate.
What is the SMILES notation for ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate?
The canonical SMILES for ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate is CCOC(=O)Nc1ccc2c(c1)N(C(=O)CN)c1ccccc1CC2.
What is the InChIKey of ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate?
The InChIKey is HJGLLZCKMKRCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O3/c1-2-25-19(24)21-15-10-9-14-8-7-13-5-3-4-6-16(13)22(17(14)11-15)18(23)12-20/h3-6,9-11H,2,7-8,12,20H2,1H3,(H,21,24).
What are the key properties of ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate?
ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate has a molecular weight of 339.40 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[11-(2-aminoacetyl)-5,6-dihydrobenzo[b][1]benzazepin-2-yl]carbamate is sourced from PubChem (CID 798455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).