About N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide
N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide (PubChem CID 798461) has the molecular formula C17H18N2O2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide.
Molecular Properties
| Compound Name | N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide |
| PubChem CID | 798461 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide |
| SMILES | Cc1cc(C)c(O)c(NC(=S)NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H18N2O2S/c1-11-8-12(2)16(21)14(9-11)18-17(22)19-15(20)10-13-6-4-3-5-7-13/h3-9,21H,10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | FZRMCIRAEKFIGO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide?
The IUPAC name of N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide (CID 798461) is N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide.
What is the SMILES notation for N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide?
The canonical SMILES for N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide is Cc1cc(C)c(O)c(NC(=S)NC(=O)Cc2ccccc2)c1.
What is the InChIKey of N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide?
The InChIKey is FZRMCIRAEKFIGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O2S/c1-11-8-12(2)16(21)14(9-11)18-17(22)19-15(20)10-13-6-4-3-5-7-13/h3-9,21H,10H2,1-2H3,(H2,18,19,20,22).
What are the key properties of N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide?
N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide has a molecular weight of 314.41 g/mol, XLogP of 3.06, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-hydroxy-3,5-dimethylphenyl)carbamothioyl]-2-phenylacetamide is sourced from PubChem (CID 798461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).