C13H22N2O3 — CID 79846171
2-[1-[(2-piperidin-4-ylacetyl)amino]cyclobutyl]acetic acid (PubChem CID 79846171) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-[1-[(2-piperidin-4-ylacetyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(2-piperidin-4-ylacetyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 79846171 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-[1-[(2-piperidin-4-ylacetyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)CC2CCNCC2)CCC1 |
| InChI | InChI=1S/C13H22N2O3/c16-11(8-10-2-6-14-7-3-10)15-13(4-1-5-13)9-12(17)18/h10,14H,1-9H2,(H,15,16)(H,17,18) |
| InChIKey | LSWPSPOFKHLRRK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |