About 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine
6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine (PubChem CID 79847235) has the molecular formula C12H25NOS
and a molecular weight of 231.40 g/mol. Its IUPAC name is 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine |
| PubChem CID | 79847235 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCC(S(=O)C(C)(C)C)C1N |
| InChI | InChI=1S/C12H25NOS/c1-11(2,3)15(14)9-7-6-8-12(4,5)10(9)13/h9-10H,6-8,13H2,1-5H3 |
| InChIKey | UXYNHKQHJUWQKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine?
The IUPAC name of 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine (CID 79847235) is 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine.
What is the SMILES notation for 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine?
The canonical SMILES for 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine is CC1(C)CCCC(S(=O)C(C)(C)C)C1N.
What is the InChIKey of 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine?
The InChIKey is UXYNHKQHJUWQKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NOS/c1-11(2,3)15(14)9-7-6-8-12(4,5)10(9)13/h9-10H,6-8,13H2,1-5H3.
What are the key properties of 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine?
6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine has a molecular weight of 231.40 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butylsulfinyl-2,2-dimethylcyclohexan-1-amine is sourced from PubChem (CID 79847235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).