C13H25NO2 — CID 79848658
2,2-dimethyl-6-(morpholin-4-ylmethyl)cyclohexan-1-ol (PubChem CID 79848658) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2,2-dimethyl-6-(morpholin-4-ylmethyl)cyclohexan-1-ol.
| Compound Name | 2,2-dimethyl-6-(morpholin-4-ylmethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 79848658 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2,2-dimethyl-6-(morpholin-4-ylmethyl)cyclohexan-1-ol |
| SMILES | CC1(C)CCCC(CN2CCOCC2)C1O |
| InChI | InChI=1S/C13H25NO2/c1-13(2)5-3-4-11(12(13)15)10-14-6-8-16-9-7-14/h11-12,15H,3-10H2,1-2H3 |
| InChIKey | YWFLMRPMCHLFLT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |