About 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine
3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine (PubChem CID 79849947) has the molecular formula C8H18ClNO2S
and a molecular weight of 227.76 g/mol. Its IUPAC name is 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine.
Molecular Properties
| Compound Name | 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine |
| PubChem CID | 79849947 |
| Molecular Formula | C8H18ClNO2S |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine |
| SMILES | CC(CCl)CN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C8H18ClNO2S/c1-8(6-9)7-10(2)4-5-13(3,11)12/h8H,4-7H2,1-3H3 |
| InChIKey | KUGHRWPNJQZUBF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine?
The IUPAC name of 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine (CID 79849947) is 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine.
What is the SMILES notation for 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine?
The canonical SMILES for 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine is CC(CCl)CN(C)CCS(C)(=O)=O.
What is the InChIKey of 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine?
The InChIKey is KUGHRWPNJQZUBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNO2S/c1-8(6-9)7-10(2)4-5-13(3,11)12/h8H,4-7H2,1-3H3.
What are the key properties of 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine?
3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine has a molecular weight of 227.76 g/mol, XLogP of 0.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N,2-dimethyl-N-(2-methylsulfonylethyl)propan-1-amine is sourced from PubChem (CID 79849947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).