C13H29N3O2S — CID 79850413
4-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1-propylpiperidin-4-amine (PubChem CID 79850413) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is 4-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1-propylpiperidin-4-amine.
| Compound Name | 4-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 79850413 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 4-(aminomethyl)-N-methyl-N-(2-methylsulfonylethyl)-1-propylpiperidin-4-amine |
| SMILES | CCCN1CCC(CN)(N(C)CCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H29N3O2S/c1-4-7-16-8-5-13(12-14,6-9-16)15(2)10-11-19(3,17)18/h4-12,14H2,1-3H3 |
| InChIKey | QHTVSQZHEHHWMK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |