About 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide
3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide (PubChem CID 79850425) has the molecular formula C8H16N4O4S2
and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide.
Molecular Properties
| Compound Name | 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide |
| PubChem CID | 79850425 |
| Molecular Formula | C8H16N4O4S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cn(C)nc1N |
| InChI | InChI=1S/C8H16N4O4S2/c1-11-6-7(8(9)10-11)18(15,16)12(2)4-5-17(3,13)14/h6H,4-5H2,1-3H3,(H2,9,10) |
| InChIKey | RQNTXRHNMZKTCM-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide?
The IUPAC name of 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide (CID 79850425) is 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide.
What is the SMILES notation for 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide?
The canonical SMILES for 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide is CN(CCS(C)(=O)=O)S(=O)(=O)c1cn(C)nc1N.
What is the InChIKey of 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide?
The InChIKey is RQNTXRHNMZKTCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O4S2/c1-11-6-7(8(9)10-11)18(15,16)12(2)4-5-17(3,13)14/h6H,4-5H2,1-3H3,(H2,9,10).
What are the key properties of 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide?
3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide has a molecular weight of 296.37 g/mol, XLogP of -1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,1-dimethyl-N-(2-methylsulfonylethyl)pyrazole-4-sulfonamide is sourced from PubChem (CID 79850425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).