C10H18N2O2S — CID 79850636
2-[1-[[methyl(2-methylsulfonylethyl)amino]methyl]cyclopropyl]acetonitrile (PubChem CID 79850636) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 2-[1-[[methyl(2-methylsulfonylethyl)amino]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[methyl(2-methylsulfonylethyl)amino]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 79850636 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-[1-[[methyl(2-methylsulfonylethyl)amino]methyl]cyclopropyl]acetonitrile |
| SMILES | CN(CCS(C)(=O)=O)CC1(CC#N)CC1 |
| InChI | InChI=1S/C10H18N2O2S/c1-12(7-8-15(2,13)14)9-10(3-4-10)5-6-11/h3-5,7-9H2,1-2H3 |
| InChIKey | ICIDYSAENQQJKL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |