C9H17N3O2 — CID 79851893
2-[[2-(1-aminocyclobutyl)acetyl]amino]propanamide (PubChem CID 79851893) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[[2-(1-aminocyclobutyl)acetyl]amino]propanamide.
| Compound Name | 2-[[2-(1-aminocyclobutyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 79851893 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[[2-(1-aminocyclobutyl)acetyl]amino]propanamide |
| SMILES | CC(NC(=O)CC1(N)CCC1)C(N)=O |
| InChI | InChI=1S/C9H17N3O2/c1-6(8(10)14)12-7(13)5-9(11)3-2-4-9/h6H,2-5,11H2,1H3,(H2,10,14)(H,12,13) |
| InChIKey | WQDWPVSYXXHFER-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |