About 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol
3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 79852758) has the molecular formula C15H31NOS
and a molecular weight of 273.49 g/mol. Its IUPAC name is 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol |
| PubChem CID | 79852758 |
| Molecular Formula | C15H31NOS |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | CCCNC1C(SCC(C)CO)CCCC1(C)C |
| InChI | InChI=1S/C15H31NOS/c1-5-9-16-14-13(18-11-12(2)10-17)7-6-8-15(14,3)4/h12-14,16-17H,5-11H2,1-4H3 |
| InChIKey | GSDMFLNKIPBESO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol?
The IUPAC name of 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol (CID 79852758) is 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol.
What is the SMILES notation for 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol?
The canonical SMILES for 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol is CCCNC1C(SCC(C)CO)CCCC1(C)C.
What is the InChIKey of 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol?
The InChIKey is GSDMFLNKIPBESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NOS/c1-5-9-16-14-13(18-11-12(2)10-17)7-6-8-15(14,3)4/h12-14,16-17H,5-11H2,1-4H3.
What are the key properties of 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol?
3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol has a molecular weight of 273.49 g/mol, XLogP of 3.29, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,3-dimethyl-2-(propylamino)cyclohexyl]sulfanyl-2-methylpropan-1-ol is sourced from PubChem (CID 79852758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).