About 2-(bromomethyl)-1,1-dimethylcyclohexane
2-(bromomethyl)-1,1-dimethylcyclohexane (PubChem CID 79853297) has the molecular formula C9H17Br
and a molecular weight of 205.14 g/mol. Its IUPAC name is 2-(bromomethyl)-1,1-dimethylcyclohexane.
Molecular Properties
| Compound Name | 2-(bromomethyl)-1,1-dimethylcyclohexane |
| PubChem CID | 79853297 |
| Molecular Formula | C9H17Br |
| Molecular Weight | 205.14 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 2-(bromomethyl)-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCCCC1CBr |
| InChI | InChI=1S/C9H17Br/c1-9(2)6-4-3-5-8(9)7-10/h8H,3-7H2,1-2H3 |
| InChIKey | IUDMLKDDOBZADK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-1,1-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-1,1-dimethylcyclohexane?
The IUPAC name of 2-(bromomethyl)-1,1-dimethylcyclohexane (CID 79853297) is 2-(bromomethyl)-1,1-dimethylcyclohexane.
What is the SMILES notation for 2-(bromomethyl)-1,1-dimethylcyclohexane?
The canonical SMILES for 2-(bromomethyl)-1,1-dimethylcyclohexane is CC1(C)CCCCC1CBr.
What is the InChIKey of 2-(bromomethyl)-1,1-dimethylcyclohexane?
The InChIKey is IUDMLKDDOBZADK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17Br/c1-9(2)6-4-3-5-8(9)7-10/h8H,3-7H2,1-2H3.
What are the key properties of 2-(bromomethyl)-1,1-dimethylcyclohexane?
2-(bromomethyl)-1,1-dimethylcyclohexane has a molecular weight of 205.14 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-1,1-dimethylcyclohexane is sourced from PubChem (CID 79853297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).