C10H16N4O — CID 79853709
2-(1-aminocyclobutyl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide (PubChem CID 79853709) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(1-aminocyclobutyl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide.
| Compound Name | 2-(1-aminocyclobutyl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 79853709 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(1-aminocyclobutyl)-N-(5-methyl-1H-pyrazol-3-yl)acetamide |
| SMILES | Cc1cc(NC(=O)CC2(N)CCC2)n[nH]1 |
| InChI | InChI=1S/C10H16N4O/c1-7-5-8(14-13-7)12-9(15)6-10(11)3-2-4-10/h5H,2-4,6,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | PPLPDVNXUQNGQG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |