C14H24N2O3 — CID 79853770
1-[[2-(1-aminocyclobutyl)acetyl]amino]-3-methylcyclohexane-1-carboxylic acid (PubChem CID 79853770) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[[2-(1-aminocyclobutyl)acetyl]amino]-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-(1-aminocyclobutyl)acetyl]amino]-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79853770 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[[2-(1-aminocyclobutyl)acetyl]amino]-3-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(NC(=O)CC2(N)CCC2)(C(=O)O)C1 |
| InChI | InChI=1S/C14H24N2O3/c1-10-4-2-7-14(8-10,12(18)19)16-11(17)9-13(15)5-3-6-13/h10H,2-9,15H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | QYXPIQQFUPKRIU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |