C11H22N2O3 — CID 79854561
2-(1-aminocyclobutyl)-N-[2-(2-methoxyethoxy)ethyl]acetamide (PubChem CID 79854561) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(1-aminocyclobutyl)-N-[2-(2-methoxyethoxy)ethyl]acetamide.
| Compound Name | 2-(1-aminocyclobutyl)-N-[2-(2-methoxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 79854561 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 2-(1-aminocyclobutyl)-N-[2-(2-methoxyethoxy)ethyl]acetamide |
| SMILES | COCCOCCNC(=O)CC1(N)CCC1 |
| InChI | InChI=1S/C11H22N2O3/c1-15-7-8-16-6-5-13-10(14)9-11(12)3-2-4-11/h2-9,12H2,1H3,(H,13,14) |
| InChIKey | PMOOIWRBBNGNAP-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|