C12H20N2O3 — CID 79854851
(2R)-1-[2-(1-aminocyclobutyl)acetyl]piperidine-2-carboxylic acid (PubChem CID 79854851) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2R)-1-[2-(1-aminocyclobutyl)acetyl]piperidine-2-carboxylic acid.
| Compound Name | (2R)-1-[2-(1-aminocyclobutyl)acetyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79854851 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2R)-1-[2-(1-aminocyclobutyl)acetyl]piperidine-2-carboxylic acid |
| SMILES | NC1(CC(=O)N2CCCC[C@@H]2C(=O)O)CCC1 |
| InChI | InChI=1S/C12H20N2O3/c13-12(5-3-6-12)8-10(15)14-7-2-1-4-9(14)11(16)17/h9H,1-8,13H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | ZJIQJUWUGOGWGL-SECBINFHSA-N |
| XLogP | 0.72 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |