C13H24F3NO2 — CID 79855153
2-(aminomethyl)-6,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol (PubChem CID 79855153) has the molecular formula C13H24F3NO2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-(aminomethyl)-6,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol.
| Compound Name | 2-(aminomethyl)-6,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 79855153 |
| Molecular Formula | C13H24F3NO2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 2-(aminomethyl)-6,6-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexan-1-ol |
| SMILES | CC1(C)CCCC(CN)(CCOCC(F)(F)F)C1O |
| InChI | InChI=1S/C13H24F3NO2/c1-11(2)4-3-5-12(8-17,10(11)18)6-7-19-9-13(14,15)16/h10,18H,3-9,17H2,1-2H3 |
| InChIKey | JGCHZVQITDDPJW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|