C14H20F3NO2 — CID 79855684
3,3-dimethyl-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile (PubChem CID 79855684) has the molecular formula C14H20F3NO2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile.
| Compound Name | 3,3-dimethyl-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 79855684 |
| Molecular Formula | C14H20F3NO2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3,3-dimethyl-2-oxo-1-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1-carbonitrile |
| SMILES | CC1(C)CCCC(C#N)(CCCOCC(F)(F)F)C1=O |
| InChI | InChI=1S/C14H20F3NO2/c1-12(2)5-3-6-13(9-18,11(12)19)7-4-8-20-10-14(15,16)17/h3-8,10H2,1-2H3 |
| InChIKey | VXOVHTUCTFCMOU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|