C13H25NO2 — CID 79856841
2,2-dimethyl-5-(oxan-2-ylmethoxy)cyclopentan-1-amine (PubChem CID 79856841) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 2,2-dimethyl-5-(oxan-2-ylmethoxy)cyclopentan-1-amine.
| Compound Name | 2,2-dimethyl-5-(oxan-2-ylmethoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 79856841 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2,2-dimethyl-5-(oxan-2-ylmethoxy)cyclopentan-1-amine |
| SMILES | CC1(C)CCC(OCC2CCCCO2)C1N |
| InChI | InChI=1S/C13H25NO2/c1-13(2)7-6-11(12(13)14)16-9-10-5-3-4-8-15-10/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | KZGFYHRXECOSRA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |