C13H28N2O4S — CID 79858080
2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentanoic acid (PubChem CID 79858080) has the molecular formula C13H28N2O4S and a molecular weight of 308.44 g/mol. Its IUPAC name is 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentanoic acid.
| Compound Name | 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentanoic acid |
|---|---|
| PubChem CID | 79858080 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-methyl-4-[methyl(2-methylsulfonylethyl)amino]-2-(propan-2-ylamino)pentanoic acid |
| SMILES | CC(C)NC(C)(CC(C)N(C)CCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C13H28N2O4S/c1-10(2)14-13(4,12(16)17)9-11(3)15(5)7-8-20(6,18)19/h10-11,14H,7-9H2,1-6H3,(H,16,17) |
| InChIKey | QVHIULUUHIHAOT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |