C17H26N2O — CID 79860799
3-[(2,2-dimethylcyclopentyl)amino]-N,N,4-trimethylbenzamide (PubChem CID 79860799) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclopentyl)amino]-N,N,4-trimethylbenzamide.
| Compound Name | 3-[(2,2-dimethylcyclopentyl)amino]-N,N,4-trimethylbenzamide |
|---|---|
| PubChem CID | 79860799 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3-[(2,2-dimethylcyclopentyl)amino]-N,N,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NC1CCCC1(C)C |
| InChI | InChI=1S/C17H26N2O/c1-12-8-9-13(16(20)19(4)5)11-14(12)18-15-7-6-10-17(15,2)3/h8-9,11,15,18H,6-7,10H2,1-5H3 |
| InChIKey | YCKQBSISDJSSCI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |