C16H21N3 — CID 79861402
2-N-(2,2-dimethylcyclopentyl)quinoline-2,6-diamine (PubChem CID 79861402) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-N-(2,2-dimethylcyclopentyl)quinoline-2,6-diamine.
| Compound Name | 2-N-(2,2-dimethylcyclopentyl)quinoline-2,6-diamine |
|---|---|
| PubChem CID | 79861402 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-N-(2,2-dimethylcyclopentyl)quinoline-2,6-diamine |
| SMILES | CC1(C)CCCC1Nc1ccc2cc(N)ccc2n1 |
| InChI | InChI=1S/C16H21N3/c1-16(2)9-3-4-14(16)19-15-8-5-11-10-12(17)6-7-13(11)18-15/h5-8,10,14H,3-4,9,17H2,1-2H3,(H,18,19) |
| InChIKey | DJMFXYMCXPENGP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|